About 3,5-dipropyl-1,2,4-trithiolane
3,5-dipropyl-1,2,4-trithiolane (PubChem CID 20567283) has the molecular formula C8H16S3
and a molecular weight of 208.42 g/mol. Its IUPAC name is 3,5-dipropyl-1,2,4-trithiolane.
Molecular Properties
| Compound Name | 3,5-dipropyl-1,2,4-trithiolane |
| PubChem CID | 20567283 |
| Molecular Formula | C8H16S3 |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3,5-dipropyl-1,2,4-trithiolane |
| SMILES | CCCC1SSC(CCC)S1 |
| InChI | InChI=1S/C8H16S3/c1-3-5-7-9-8(6-4-2)11-10-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | RJVZZGYMVBJRLX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dipropyl-1,2,4-trithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dipropyl-1,2,4-trithiolane?
The IUPAC name of 3,5-dipropyl-1,2,4-trithiolane (CID 20567283) is 3,5-dipropyl-1,2,4-trithiolane.
What is the SMILES notation for 3,5-dipropyl-1,2,4-trithiolane?
The canonical SMILES for 3,5-dipropyl-1,2,4-trithiolane is CCCC1SSC(CCC)S1.
What is the InChIKey of 3,5-dipropyl-1,2,4-trithiolane?
The InChIKey is RJVZZGYMVBJRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S3/c1-3-5-7-9-8(6-4-2)11-10-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 3,5-dipropyl-1,2,4-trithiolane?
3,5-dipropyl-1,2,4-trithiolane has a molecular weight of 208.42 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dipropyl-1,2,4-trithiolane is sourced from PubChem (CID 20567283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).