About N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide
N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide (PubChem CID 20567302) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide |
| PubChem CID | 20567302 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C9H12N2O3/c1-2-7(12)10-5-6-11-8(13)3-4-9(11)14/h2H,1,3-6H2,(H,10,12) |
| InChIKey | NOBWWCZNYHMSCW-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide?
The IUPAC name of N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide (CID 20567302) is N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide?
The canonical SMILES for N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide is C=CC(=O)NCCN1C(=O)CCC1=O.
What is the InChIKey of N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide?
The InChIKey is NOBWWCZNYHMSCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-2-7(12)10-5-6-11-8(13)3-4-9(11)14/h2H,1,3-6H2,(H,10,12).
What are the key properties of N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide?
N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide has a molecular weight of 196.21 g/mol, XLogP of -0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]prop-2-enamide is sourced from PubChem (CID 20567302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).