About 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine
2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine (PubChem CID 20567777) has the molecular formula C8H15N5S
and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine.
Molecular Properties
| Compound Name | 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine |
| PubChem CID | 20567777 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine |
| SMILES | C/N=C(\N)NCCNCc1nccs1 |
| InChI | InChI=1S/C8H15N5S/c1-10-8(9)13-3-2-11-6-7-12-4-5-14-7/h4-5,11H,2-3,6H2,1H3,(H3,9,10,13) |
| InChIKey | TVLGXCYGMRZAJF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine?
The IUPAC name of 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine (CID 20567777) is 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine.
What is the SMILES notation for 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine?
The canonical SMILES for 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine is C/N=C(\N)NCCNCc1nccs1.
What is the InChIKey of 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine?
The InChIKey is TVLGXCYGMRZAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5S/c1-10-8(9)13-3-2-11-6-7-12-4-5-14-7/h4-5,11H,2-3,6H2,1H3,(H3,9,10,13).
What are the key properties of 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine?
2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine has a molecular weight of 213.31 g/mol, XLogP of -0.23, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]guanidine is sourced from PubChem (CID 20567777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).