About 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine
2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine (PubChem CID 20567906) has the molecular formula C7H8BrNO
and a molecular weight of 202.05 g/mol. Its IUPAC name is 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine.
Molecular Properties
| Compound Name | 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine |
| PubChem CID | 20567906 |
| Molecular Formula | C7H8BrNO |
| Molecular Weight | 202.05 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine |
| SMILES | BrC1=C2C=CC(=C1)C2.NO |
| InChI | InChI=1S/C7H5Br.H3NO/c8-7-4-5-1-2-6(7)3-5;1-2/h1-2,4H,3H2;2H,1H2 |
| InChIKey | HSFBTOMDFQXFCR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.05 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine?
The IUPAC name of 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine (CID 20567906) is 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine.
What is the SMILES notation for 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine?
The canonical SMILES for 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine is BrC1=C2C=CC(=C1)C2.NO.
What is the InChIKey of 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine?
The InChIKey is HSFBTOMDFQXFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br.H3NO/c8-7-4-5-1-2-6(7)3-5;1-2/h1-2,4H,3H2;2H,1H2.
What are the key properties of 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine?
2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine has a molecular weight of 202.05 g/mol, XLogP of 1.87, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobicyclo[2.2.1]hepta-1,3,5-triene;hydroxylamine is sourced from PubChem (CID 20567906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).