C15H21N3O4 — CID 20568160
1-[(3-methyloxiran-2-yl)methyl]-3,5-bis(2-methylprop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 20568160) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[(3-methyloxiran-2-yl)methyl]-3,5-bis(2-methylprop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(3-methyloxiran-2-yl)methyl]-3,5-bis(2-methylprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20568160 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[(3-methyloxiran-2-yl)methyl]-3,5-bis(2-methylprop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C(C)Cn1c(=O)n(CC(=C)C)c(=O)n(CC2OC2C)c1=O |
| InChI | InChI=1S/C15H21N3O4/c1-9(2)6-16-13(19)17(7-10(3)4)15(21)18(14(16)20)8-12-11(5)22-12/h11-12H,1,3,6-8H2,2,4-5H3 |
| InChIKey | QSVJXCIABOKGMT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|