About [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate
[(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate (PubChem CID 20568289) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate |
| PubChem CID | 20568289 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/C1C=C(C)CCO1 |
| InChI | InChI=1S/C11H16O3/c1-9-5-7-14-11(8-9)4-3-6-13-10(2)12/h3-4,8,11H,5-7H2,1-2H3/b4-3+ |
| InChIKey | ASOFSEUJZRTLGD-ONEGZZNKSA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate?
The IUPAC name of [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate (CID 20568289) is [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate.
What is the SMILES notation for [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate?
The canonical SMILES for [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate is CC(=O)OC/C=C/C1C=C(C)CCO1.
What is the InChIKey of [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate?
The InChIKey is ASOFSEUJZRTLGD-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H16O3/c1-9-5-7-14-11(8-9)4-3-6-13-10(2)12/h3-4,8,11H,5-7H2,1-2H3/b4-3+.
What are the key properties of [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate?
[(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate has a molecular weight of 196.25 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(4-methyl-3,6-dihydro-2H-pyran-6-yl)prop-2-enyl] acetate is sourced from PubChem (CID 20568289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).