C8H11NO3S — CID 20568744
ethyl (E)-3-(4-oxoazetidin-2-yl)sulfanylprop-2-enoate (PubChem CID 20568744) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is ethyl (E)-3-(4-oxoazetidin-2-yl)sulfanylprop-2-enoate.
| Compound Name | ethyl (E)-3-(4-oxoazetidin-2-yl)sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 20568744 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | ethyl (E)-3-(4-oxoazetidin-2-yl)sulfanylprop-2-enoate |
| SMILES | CCOC(=O)/C=C/SC1CC(=O)N1 |
| InChI | InChI=1S/C8H11NO3S/c1-2-12-8(11)3-4-13-7-5-6(10)9-7/h3-4,7H,2,5H2,1H3,(H,9,10)/b4-3+ |
| InChIKey | HEDFNYSIPDHXHV-ONEGZZNKSA-N |
| XLogP | 0.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|