About N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine
N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine (PubChem CID 2056876) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine |
| PubChem CID | 2056876 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine |
| SMILES | C/C=C(\C)CN(C)CCN(CC)CC |
| InChI | InChI=1S/C12H26N2/c1-6-12(4)11-13(5)9-10-14(7-2)8-3/h6H,7-11H2,1-5H3/b12-6+ |
| InChIKey | HNZKSYVZPAMHEK-WUXMJOGZSA-N |
| XLogP | 2.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine?
The IUPAC name of N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine (CID 2056876) is N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine.
What is the SMILES notation for N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine?
The canonical SMILES for N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine is C/C=C(\C)CN(C)CCN(CC)CC.
What is the InChIKey of N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine?
The InChIKey is HNZKSYVZPAMHEK-WUXMJOGZSA-N. The full InChI is InChI=1S/C12H26N2/c1-6-12(4)11-13(5)9-10-14(7-2)8-3/h6H,7-11H2,1-5H3/b12-6+.
What are the key properties of N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine?
N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.23, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethyl-N-methyl-N-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine is sourced from PubChem (CID 2056876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).