C28H32N4O6 — CID 20568858
(E)-but-2-enedioate;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one) (PubChem CID 20568858) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is (E)-but-2-enedioate;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one).
| Compound Name | (E)-but-2-enedioate;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one) |
|---|---|
| PubChem CID | 20568858 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (E)-but-2-enedioate;bis(3-ethyl-2,6-dimethylpyrido[1,2-a]pyrimidin-1-ium-4-one) |
| SMILES | CCc1c(C)[nH+]c2cccc(C)n2c1=O.CCc1c(C)[nH+]c2cccc(C)n2c1=O.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/2C12H14N2O.C4H4O4/c2*1-4-10-9(3)13-11-7-5-6-8(2)14(11)12(10)15;5-3(6)1-2-4(7)8/h2*5-7H,4H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | UIHAPHUEOXZRRA-WXXKFALUSA-N |
| XLogP | -0.37 |
| TPSA | 151.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|