C13H24N2O — CID 20568868
3-ethyl-1,2,6-trimethyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 20568868) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 3-ethyl-1,2,6-trimethyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-ethyl-1,2,6-trimethyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 20568868 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 3-ethyl-1,2,6-trimethyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCC1C(=O)N2C(C)CCCC2N(C)C1C |
| InChI | InChI=1S/C13H24N2O/c1-5-11-10(3)14(4)12-8-6-7-9(2)15(12)13(11)16/h9-12H,5-8H2,1-4H3 |
| InChIKey | NQSXRQCKILMXSA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |