About butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane
butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 20569147) has the molecular formula C10H23N5
and a molecular weight of 213.33 g/mol. Its IUPAC name is butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
Analyze butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane?
The IUPAC name of butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (CID 20569147) is butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane?
The canonical SMILES for butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane is C1N2CN3CN1CN(C2)C3.CCCCN.
What is the InChIKey of butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane?
The InChIKey is BGRFJWZEDNLAMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.C4H11N/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-3-4-5/h1-6H2;2-5H2,1H3.
What are the key properties of butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane?
butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane has a molecular weight of 213.33 g/mol, XLogP of -0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 20569147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).