C13H28N2 — CID 2056916
N,N,N'-triethyl-N'-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine (PubChem CID 2056916) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine.
| Compound Name | N,N,N'-triethyl-N'-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2056916 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N,N,N'-triethyl-N'-[(E)-2-methylbut-2-enyl]ethane-1,2-diamine |
| SMILES | C/C=C(\C)CN(CC)CCN(CC)CC |
| InChI | InChI=1S/C13H28N2/c1-6-13(5)12-15(9-4)11-10-14(7-2)8-3/h6H,7-12H2,1-5H3/b13-6+ |
| InChIKey | ZGHUIPQYEBWEDX-AWNIVKPZSA-N |
| XLogP | 2.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|