About 1,3,5-tribromoacenaphthylene
1,3,5-tribromoacenaphthylene (PubChem CID 20569463) has the molecular formula C12H5Br3
and a molecular weight of 388.88 g/mol. Its IUPAC name is 1,3,5-tribromoacenaphthylene.
Molecular Properties
| Compound Name | 1,3,5-tribromoacenaphthylene |
| PubChem CID | 20569463 |
| Molecular Formula | C12H5Br3 |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 385.79 |
| IUPAC Name | 1,3,5-tribromoacenaphthylene |
| SMILES | BrC1=Cc2c(Br)cc(Br)c3cccc1c23 |
| InChI | InChI=1S/C12H5Br3/c13-9-4-8-11(15)5-10(14)7-3-1-2-6(9)12(7)8/h1-5H |
| InChIKey | AGRWTNGSIVHIKF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3,5-tribromoacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-tribromoacenaphthylene?
The IUPAC name of 1,3,5-tribromoacenaphthylene (CID 20569463) is 1,3,5-tribromoacenaphthylene.
What is the SMILES notation for 1,3,5-tribromoacenaphthylene?
The canonical SMILES for 1,3,5-tribromoacenaphthylene is BrC1=Cc2c(Br)cc(Br)c3cccc1c23.
What is the InChIKey of 1,3,5-tribromoacenaphthylene?
The InChIKey is AGRWTNGSIVHIKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Br3/c13-9-4-8-11(15)5-10(14)7-3-1-2-6(9)12(7)8/h1-5H.
What are the key properties of 1,3,5-tribromoacenaphthylene?
1,3,5-tribromoacenaphthylene has a molecular weight of 388.88 g/mol, XLogP of 5.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-tribromoacenaphthylene is sourced from PubChem (CID 20569463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).