About 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride
4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride (PubChem CID 20569593) has the molecular formula C11H16BrClN2OS
and a molecular weight of 339.69 g/mol. Its IUPAC name is 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride |
| PubChem CID | 20569593 |
| Molecular Formula | C11H16BrClN2OS |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride |
| SMILES | Cc1cc(N2CCS(=O)CC2)c(Br)c(C)n1.Cl |
| InChI | InChI=1S/C11H15BrN2OS.ClH/c1-8-7-10(11(12)9(2)13-8)14-3-5-16(15)6-4-14;/h7H,3-6H2,1-2H3;1H |
| InChIKey | CYWCMNCNNQMRIR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride?
The IUPAC name of 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride (CID 20569593) is 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride.
What is the SMILES notation for 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride?
The canonical SMILES for 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride is Cc1cc(N2CCS(=O)CC2)c(Br)c(C)n1.Cl.
What is the InChIKey of 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride?
The InChIKey is CYWCMNCNNQMRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2OS.ClH/c1-8-7-10(11(12)9(2)13-8)14-3-5-16(15)6-4-14;/h7H,3-6H2,1-2H3;1H.
What are the key properties of 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride?
4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride has a molecular weight of 339.69 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-2,6-dimethyl-4-pyridinyl)-1,4-thiazinane 1-oxide;hydrochloride is sourced from PubChem (CID 20569593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).