About 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one
1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one (PubChem CID 20569685) has the molecular formula C18H14ClN3O3S
and a molecular weight of 387.85 g/mol. Its IUPAC name is 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one |
| PubChem CID | 20569685 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one |
| SMILES | O=C(CCn1cccn1)N1c2ccccc2S(=O)(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H14ClN3O3S/c19-13-6-7-17-15(12-13)22(18(23)8-11-21-10-3-9-20-21)14-4-1-2-5-16(14)26(17,24)25/h1-7,9-10,12H,8,11H2 |
| InChIKey | TZLNANGCIOETBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one?
The IUPAC name of 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one (CID 20569685) is 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one.
What is the SMILES notation for 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one?
The canonical SMILES for 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one is O=C(CCn1cccn1)N1c2ccccc2S(=O)(=O)c2ccc(Cl)cc21.
What is the InChIKey of 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one?
The InChIKey is TZLNANGCIOETBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3O3S/c19-13-6-7-17-15(12-13)22(18(23)8-11-21-10-3-9-20-21)14-4-1-2-5-16(14)26(17,24)25/h1-7,9-10,12H,8,11H2.
What are the key properties of 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one?
1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one has a molecular weight of 387.85 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-5,5-dioxophenothiazin-10-yl)-3-pyrazol-1-ylpropan-1-one is sourced from PubChem (CID 20569685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).