C10H21N3O — CID 20569907
1-methyl-1-piperidin-4-yl-3-propylurea (PubChem CID 20569907) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-methyl-1-piperidin-4-yl-3-propylurea.
| Compound Name | 1-methyl-1-piperidin-4-yl-3-propylurea |
|---|---|
| PubChem CID | 20569907 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 1-methyl-1-piperidin-4-yl-3-propylurea |
| SMILES | CCCNC(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C10H21N3O/c1-3-6-12-10(14)13(2)9-4-7-11-8-5-9/h9,11H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | QYXJDGOCMKVUDO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |