About piperidin-4-yl N-ethylcarbamate
piperidin-4-yl N-ethylcarbamate (PubChem CID 20569908) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is piperidin-4-yl N-ethylcarbamate.
Molecular Properties
| Compound Name | piperidin-4-yl N-ethylcarbamate |
| PubChem CID | 20569908 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | piperidin-4-yl N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCNCC1 |
| InChI | InChI=1S/C8H16N2O2/c1-2-10-8(11)12-7-3-5-9-6-4-7/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | JIYLLYLKTJCEEL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl N-ethylcarbamate?
The IUPAC name of piperidin-4-yl N-ethylcarbamate (CID 20569908) is piperidin-4-yl N-ethylcarbamate.
What is the SMILES notation for piperidin-4-yl N-ethylcarbamate?
The canonical SMILES for piperidin-4-yl N-ethylcarbamate is CCNC(=O)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl N-ethylcarbamate?
The InChIKey is JIYLLYLKTJCEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-2-10-8(11)12-7-3-5-9-6-4-7/h7,9H,2-6H2,1H3,(H,10,11).
What are the key properties of piperidin-4-yl N-ethylcarbamate?
piperidin-4-yl N-ethylcarbamate has a molecular weight of 172.23 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl N-ethylcarbamate is sourced from PubChem (CID 20569908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).