C6H10N4O2 — CID 20570049
5-amino-2-(2-hydroxyethylamino)-1H-pyrimidin-6-one (PubChem CID 20570049) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-amino-2-(2-hydroxyethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-2-(2-hydroxyethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 20570049 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5-amino-2-(2-hydroxyethylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1cnc(NCCO)[nH]c1=O |
| InChI | InChI=1S/C6H10N4O2/c7-4-3-9-6(8-1-2-11)10-5(4)12/h3,11H,1-2,7H2,(H2,8,9,10,12) |
| InChIKey | TYSKGJCMHXNKTC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |