About 4-hydroxynaphthalene-2,7-disulfonamide
4-hydroxynaphthalene-2,7-disulfonamide (PubChem CID 2057050) has the molecular formula C10H10N2O5S2
and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-hydroxynaphthalene-2,7-disulfonamide.
Molecular Properties
| Compound Name | 4-hydroxynaphthalene-2,7-disulfonamide |
| PubChem CID | 2057050 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 4-hydroxynaphthalene-2,7-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(O)cc(S(N)(=O)=O)cc2c1 |
| InChI | InChI=1S/C10H10N2O5S2/c11-18(14,15)7-1-2-9-6(3-7)4-8(5-10(9)13)19(12,16)17/h1-5,13H,(H2,11,14,15)(H2,12,16,17) |
| InChIKey | ZPTDDLASEJQVPG-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxynaphthalene-2,7-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxynaphthalene-2,7-disulfonamide?
The IUPAC name of 4-hydroxynaphthalene-2,7-disulfonamide (CID 2057050) is 4-hydroxynaphthalene-2,7-disulfonamide.
What is the SMILES notation for 4-hydroxynaphthalene-2,7-disulfonamide?
The canonical SMILES for 4-hydroxynaphthalene-2,7-disulfonamide is NS(=O)(=O)c1ccc2c(O)cc(S(N)(=O)=O)cc2c1.
What is the InChIKey of 4-hydroxynaphthalene-2,7-disulfonamide?
The InChIKey is ZPTDDLASEJQVPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5S2/c11-18(14,15)7-1-2-9-6(3-7)4-8(5-10(9)13)19(12,16)17/h1-5,13H,(H2,11,14,15)(H2,12,16,17).
What are the key properties of 4-hydroxynaphthalene-2,7-disulfonamide?
4-hydroxynaphthalene-2,7-disulfonamide has a molecular weight of 302.33 g/mol, XLogP of -0.16, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxynaphthalene-2,7-disulfonamide is sourced from PubChem (CID 2057050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).