About 6-formyloctanenitrile
6-formyloctanenitrile (PubChem CID 20570606) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 6-formyloctanenitrile.
Molecular Properties
| Compound Name | 6-formyloctanenitrile |
| PubChem CID | 20570606 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 6-formyloctanenitrile |
| SMILES | CCC(C=O)CCCCC#N |
| InChI | InChI=1S/C9H15NO/c1-2-9(8-11)6-4-3-5-7-10/h8-9H,2-6H2,1H3 |
| InChIKey | HBEZBTVVFZCJOA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-formyloctanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-formyloctanenitrile?
The IUPAC name of 6-formyloctanenitrile (CID 20570606) is 6-formyloctanenitrile.
What is the SMILES notation for 6-formyloctanenitrile?
The canonical SMILES for 6-formyloctanenitrile is CCC(C=O)CCCCC#N.
What is the InChIKey of 6-formyloctanenitrile?
The InChIKey is HBEZBTVVFZCJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-2-9(8-11)6-4-3-5-7-10/h8-9H,2-6H2,1H3.
What are the key properties of 6-formyloctanenitrile?
6-formyloctanenitrile has a molecular weight of 153.22 g/mol, XLogP of 2.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-formyloctanenitrile is sourced from PubChem (CID 20570606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).