About N-(2-ethenoxyethyl)-N'-propan-2-yloxamide
N-(2-ethenoxyethyl)-N'-propan-2-yloxamide (PubChem CID 2057115) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is N-(2-ethenoxyethyl)-N'-propan-2-yloxamide.
Molecular Properties
| Compound Name | N-(2-ethenoxyethyl)-N'-propan-2-yloxamide |
| PubChem CID | 2057115 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | N-(2-ethenoxyethyl)-N'-propan-2-yloxamide |
| SMILES | C=COCCNC(=O)C(=O)NC(C)C |
| InChI | InChI=1S/C9H16N2O3/c1-4-14-6-5-10-8(12)9(13)11-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,10,12)(H,11,13) |
| InChIKey | HLTXPIMUIXIMQH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethenoxyethyl)-N'-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethenoxyethyl)-N'-propan-2-yloxamide?
The IUPAC name of N-(2-ethenoxyethyl)-N'-propan-2-yloxamide (CID 2057115) is N-(2-ethenoxyethyl)-N'-propan-2-yloxamide.
What is the SMILES notation for N-(2-ethenoxyethyl)-N'-propan-2-yloxamide?
The canonical SMILES for N-(2-ethenoxyethyl)-N'-propan-2-yloxamide is C=COCCNC(=O)C(=O)NC(C)C.
What is the InChIKey of N-(2-ethenoxyethyl)-N'-propan-2-yloxamide?
The InChIKey is HLTXPIMUIXIMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-4-14-6-5-10-8(12)9(13)11-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,10,12)(H,11,13).
What are the key properties of N-(2-ethenoxyethyl)-N'-propan-2-yloxamide?
N-(2-ethenoxyethyl)-N'-propan-2-yloxamide has a molecular weight of 200.24 g/mol, XLogP of -0.21, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethenoxyethyl)-N'-propan-2-yloxamide is sourced from PubChem (CID 2057115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).