C10H13NO — CID 20571244
6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 20571244) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 20571244 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1cc(C)c2c(c1)NCCO2 |
| InChI | InChI=1S/C10H13NO/c1-7-5-8(2)10-9(6-7)11-3-4-12-10/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | HOZBUSLWBZQCSC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |