About 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde
1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 20571336) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 20571336 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CC(C)OC1=CCC(C=O)(OC(C)C)C=C1 |
| InChI | InChI=1S/C13H20O3/c1-10(2)15-12-5-7-13(9-14,8-6-12)16-11(3)4/h5-7,9-11H,8H2,1-4H3 |
| InChIKey | FCAAHNZXUHCBNB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde (CID 20571336) is 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde is CC(C)OC1=CCC(C=O)(OC(C)C)C=C1.
What is the InChIKey of 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is FCAAHNZXUHCBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-10(2)15-12-5-7-13(9-14,8-6-12)16-11(3)4/h5-7,9-11H,8H2,1-4H3.
What are the key properties of 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde?
1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 224.30 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-di(propan-2-yloxy)cyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 20571336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).