About sodium 2-(3-nitrophenyl)acetate
sodium 2-(3-nitrophenyl)acetate (PubChem CID 20571503) has the molecular formula C8H6NNaO4
and a molecular weight of 203.13 g/mol. Its IUPAC name is sodium 2-(3-nitrophenyl)acetate.
Molecular Properties
| Compound Name | sodium 2-(3-nitrophenyl)acetate |
| PubChem CID | 20571503 |
| Molecular Formula | C8H6NNaO4 |
| Molecular Weight | 203.13 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | sodium 2-(3-nitrophenyl)acetate |
| SMILES | O=C([O-])Cc1cccc([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C8H7NO4.Na/c10-8(11)5-6-2-1-3-7(4-6)9(12)13;/h1-4H,5H2,(H,10,11);/q;+1/p-1 |
| InChIKey | KNJPJVKYOILGSW-UHFFFAOYSA-M |
| XLogP | -3.11 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.13 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-(3-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(3-nitrophenyl)acetate?
The IUPAC name of sodium 2-(3-nitrophenyl)acetate (CID 20571503) is sodium 2-(3-nitrophenyl)acetate.
What is the SMILES notation for sodium 2-(3-nitrophenyl)acetate?
The canonical SMILES for sodium 2-(3-nitrophenyl)acetate is O=C([O-])Cc1cccc([N+](=O)[O-])c1.[Na+].
What is the InChIKey of sodium 2-(3-nitrophenyl)acetate?
The InChIKey is KNJPJVKYOILGSW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO4.Na/c10-8(11)5-6-2-1-3-7(4-6)9(12)13;/h1-4H,5H2,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 2-(3-nitrophenyl)acetate?
sodium 2-(3-nitrophenyl)acetate has a molecular weight of 203.13 g/mol, XLogP of -3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(3-nitrophenyl)acetate is sourced from PubChem (CID 20571503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).