sodium 2-(3-nitrophenyl)acetate

C8H6NNaO4 — CID 20571503

IUPACsodium 2-(3-nitrophenyl)acetate
SMILESO=C([O-])Cc1cccc([N+](=O)[O-])c1.[Na+]
InChIInChI=1S/C8H7NO4.Na/c10-8(11)5-6-2-1-3-7(4-6)9(12)13;/h1-4H,5H2,(H,10,11);/q;+1/p-1
InChIKeyKNJPJVKYOILGSW-UHFFFAOYSA-M
MW203.13 g/mol
LogP-3.11
Rot. Bonds3

About sodium 2-(3-nitrophenyl)acetate

sodium 2-(3-nitrophenyl)acetate (PubChem CID 20571503) has the molecular formula C8H6NNaO4 and a molecular weight of 203.13 g/mol. Its IUPAC name is sodium 2-(3-nitrophenyl)acetate.

Molecular Properties

Compound Namesodium 2-(3-nitrophenyl)acetate
PubChem CID20571503
Molecular FormulaC8H6NNaO4
Molecular Weight203.13 g/mol
Exact Mass203.02
IUPAC Namesodium 2-(3-nitrophenyl)acetate
SMILESO=C([O-])Cc1cccc([N+](=O)[O-])c1.[Na+]
InChIInChI=1S/C8H7NO4.Na/c10-8(11)5-6-2-1-3-7(4-6)9(12)13;/h1-4H,5H2,(H,10,11);/q;+1/p-1
InChIKeyKNJPJVKYOILGSW-UHFFFAOYSA-M
XLogP-3.11
TPSA83.27 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.13
LogP ≤ 5-3.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze sodium 2-(3-nitrophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(3-nitrophenyl)acetate?
The IUPAC name of sodium 2-(3-nitrophenyl)acetate (CID 20571503) is sodium 2-(3-nitrophenyl)acetate.
What is the SMILES notation for sodium 2-(3-nitrophenyl)acetate?
The canonical SMILES for sodium 2-(3-nitrophenyl)acetate is O=C([O-])Cc1cccc([N+](=O)[O-])c1.[Na+].
What is the InChIKey of sodium 2-(3-nitrophenyl)acetate?
The InChIKey is KNJPJVKYOILGSW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO4.Na/c10-8(11)5-6-2-1-3-7(4-6)9(12)13;/h1-4H,5H2,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 2-(3-nitrophenyl)acetate?
sodium 2-(3-nitrophenyl)acetate has a molecular weight of 203.13 g/mol, XLogP of -3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(3-nitrophenyl)acetate is sourced from PubChem (CID 20571503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).