About (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate
(2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate (PubChem CID 20571771) has the molecular formula C20H26BrO7PS2
and a molecular weight of 553.43 g/mol. Its IUPAC name is (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate.
Molecular Properties
| Compound Name | (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate |
| PubChem CID | 20571771 |
| Molecular Formula | C20H26BrO7PS2 |
| Molecular Weight | 553.43 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate |
| SMILES | CCCCCSP(=O)(OCC)Oc1ccc(S(=O)(=O)Oc2ccccc2Br)c(OC)c1 |
| InChI | InChI=1S/C20H26BrO7PS2/c1-4-6-9-14-30-29(22,26-5-2)27-16-12-13-20(19(15-16)25-3)31(23,24)28-18-11-8-7-10-17(18)21/h7-8,10-13,15H,4-6,9,14H2,1-3H3 |
| InChIKey | MIJRDNAWKNVZRI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate?
The IUPAC name of (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate (CID 20571771) is (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate.
What is the SMILES notation for (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate?
The canonical SMILES for (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate is CCCCCSP(=O)(OCC)Oc1ccc(S(=O)(=O)Oc2ccccc2Br)c(OC)c1.
What is the InChIKey of (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate?
The InChIKey is MIJRDNAWKNVZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26BrO7PS2/c1-4-6-9-14-30-29(22,26-5-2)27-16-12-13-20(19(15-16)25-3)31(23,24)28-18-11-8-7-10-17(18)21/h7-8,10-13,15H,4-6,9,14H2,1-3H3.
What are the key properties of (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate?
(2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate has a molecular weight of 553.43 g/mol, XLogP of 6.67, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl) 4-[ethoxy(pentylsulfanyl)phosphoryl]oxy-2-methoxybenzenesulfonate is sourced from PubChem (CID 20571771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).