(2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide

C8H16N6O5S — CID 20572221

IUPAC(2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide
SMILESNc1nc(N2CCCCC2)nc(N)[n+]1OS(=O)(=O)O.[OH-]
InChIInChI=1S/C8H14N6O4S.H2O/c9-6-11-8(13-4-2-1-3-5-13)12-7(10)14(6)18-19(15,16)17;/h1-5H2,(H4,9,10,11,12,15,16,17);1H2
InChIKeyYJERJOFXWLQPRV-UHFFFAOYSA-N
MW308.32 g/mol
LogP-2.03
Rot. Bonds3

About (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide

(2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide (PubChem CID 20572221) has the molecular formula C8H16N6O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide.

Molecular Properties

Compound Name(2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide
PubChem CID20572221
Molecular FormulaC8H16N6O5S
Molecular Weight308.32 g/mol
Exact Mass308.09
IUPAC Name(2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide
SMILESNc1nc(N2CCCCC2)nc(N)[n+]1OS(=O)(=O)O.[OH-]
InChIInChI=1S/C8H14N6O4S.H2O/c9-6-11-8(13-4-2-1-3-5-13)12-7(10)14(6)18-19(15,16)17;/h1-5H2,(H4,9,10,11,12,15,16,17);1H2
InChIKeyYJERJOFXWLQPRV-UHFFFAOYSA-N
XLogP-2.03
TPSA178.54 Ų
H-Bond Donors3
H-Bond Acceptors9
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.32
LogP ≤ 5-2.03
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide?
The IUPAC name of (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide (CID 20572221) is (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide.
What is the SMILES notation for (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide?
The canonical SMILES for (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide is Nc1nc(N2CCCCC2)nc(N)[n+]1OS(=O)(=O)O.[OH-].
What is the InChIKey of (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide?
The InChIKey is YJERJOFXWLQPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6O4S.H2O/c9-6-11-8(13-4-2-1-3-5-13)12-7(10)14(6)18-19(15,16)17;/h1-5H2,(H4,9,10,11,12,15,16,17);1H2.
What are the key properties of (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide?
(2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide has a molecular weight of 308.32 g/mol, XLogP of -2.03, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-diamino-4-piperidin-1-yl-1,3,5-triazin-1-ium-1-yl) hydrogen sulfate hydroxide is sourced from PubChem (CID 20572221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).