About 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine
1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine (PubChem CID 20572598) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine |
| PubChem CID | 20572598 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine |
| SMILES | CC(ON=C1CCCCCCCCCCC1)N(C)C |
| InChI | InChI=1S/C16H32N2O/c1-15(18(2)3)19-17-16-13-11-9-7-5-4-6-8-10-12-14-16/h15H,4-14H2,1-3H3 |
| InChIKey | JNNZBLLVFXJWBZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine?
The IUPAC name of 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine (CID 20572598) is 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine.
What is the SMILES notation for 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine?
The canonical SMILES for 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine is CC(ON=C1CCCCCCCCCCC1)N(C)C.
What is the InChIKey of 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine?
The InChIKey is JNNZBLLVFXJWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O/c1-15(18(2)3)19-17-16-13-11-9-7-5-4-6-8-10-12-14-16/h15H,4-14H2,1-3H3.
What are the key properties of 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine?
1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine has a molecular weight of 268.44 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclododecylideneamino)oxy-N,N-dimethylethanamine is sourced from PubChem (CID 20572598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).