C18H20N4O3 — CID 20572617
9-ethyl-1,9-dimethyl-5-(4-nitrophenyl)-10-oxa-3,4,6-triazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (PubChem CID 20572617) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 9-ethyl-1,9-dimethyl-5-(4-nitrophenyl)-10-oxa-3,4,6-triazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 9-ethyl-1,9-dimethyl-5-(4-nitrophenyl)-10-oxa-3,4,6-triazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 20572617 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 9-ethyl-1,9-dimethyl-5-(4-nitrophenyl)-10-oxa-3,4,6-triazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| SMILES | CCC1(C)OC2(C)CCC1c1nc(-c3ccc([N+](=O)[O-])cc3)nnc12 |
| InChI | InChI=1S/C18H20N4O3/c1-4-17(2)13-9-10-18(3,25-17)15-14(13)19-16(21-20-15)11-5-7-12(8-6-11)22(23)24/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | PPAZSRHTMIZSBR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|