About 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine
3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine (PubChem CID 20573036) has the molecular formula C16H25NS
and a molecular weight of 263.45 g/mol. Its IUPAC name is 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 20573036 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccc(SC2CCCC2)cc1 |
| InChI | InChI=1S/C16H25NS/c1-17(2)13-5-6-14-9-11-16(12-10-14)18-15-7-3-4-8-15/h9-12,15H,3-8,13H2,1-2H3 |
| InChIKey | WLGIDGLQLGYGOO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine (CID 20573036) is 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine is CN(C)CCCc1ccc(SC2CCCC2)cc1.
What is the InChIKey of 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine?
The InChIKey is WLGIDGLQLGYGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NS/c1-17(2)13-5-6-14-9-11-16(12-10-14)18-15-7-3-4-8-15/h9-12,15H,3-8,13H2,1-2H3.
What are the key properties of 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine?
3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine has a molecular weight of 263.45 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyclopentylsulfanylphenyl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 20573036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).