C24H30N2OS — CID 20573264
3-imidazol-1-yl-2-methyl-1-[4-(3-methylbutylsulfanyl)phenyl]-1-phenylpropan-2-ol (PubChem CID 20573264) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is 3-imidazol-1-yl-2-methyl-1-[4-(3-methylbutylsulfanyl)phenyl]-1-phenylpropan-2-ol.
| Compound Name | 3-imidazol-1-yl-2-methyl-1-[4-(3-methylbutylsulfanyl)phenyl]-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 20573264 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-imidazol-1-yl-2-methyl-1-[4-(3-methylbutylsulfanyl)phenyl]-1-phenylpropan-2-ol |
| SMILES | CC(C)CCSc1ccc(C(c2ccccc2)C(C)(O)Cn2ccnc2)cc1 |
| InChI | InChI=1S/C24H30N2OS/c1-19(2)13-16-28-22-11-9-21(10-12-22)23(20-7-5-4-6-8-20)24(3,27)17-26-15-14-25-18-26/h4-12,14-15,18-19,23,27H,13,16-17H2,1-3H3 |
| InChIKey | BGGSIJBPZHTJMQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |