2-(2,2,2-trifluoroethylsulfinyl)acetic acid

C4H5F3O3S — CID 20574023

IUPAC2-(2,2,2-trifluoroethylsulfinyl)acetic acid
SMILESO=C(O)CS(=O)CC(F)(F)F
InChIInChI=1S/C4H5F3O3S/c5-4(6,7)2-11(10)1-3(8)9/h1-2H2,(H,8,9)
InChIKeyFIAZTSFGZORROG-UHFFFAOYSA-N
MW190.14 g/mol
LogP0.38
Rot. Bonds3

About 2-(2,2,2-trifluoroethylsulfinyl)acetic acid

2-(2,2,2-trifluoroethylsulfinyl)acetic acid (PubChem CID 20574023) has the molecular formula C4H5F3O3S and a molecular weight of 190.14 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfinyl)acetic acid.

Molecular Properties

Compound Name2-(2,2,2-trifluoroethylsulfinyl)acetic acid
PubChem CID20574023
Molecular FormulaC4H5F3O3S
Molecular Weight190.14 g/mol
Exact Mass189.99
IUPAC Name2-(2,2,2-trifluoroethylsulfinyl)acetic acid
SMILESO=C(O)CS(=O)CC(F)(F)F
InChIInChI=1S/C4H5F3O3S/c5-4(6,7)2-11(10)1-3(8)9/h1-2H2,(H,8,9)
InChIKeyFIAZTSFGZORROG-UHFFFAOYSA-N
XLogP0.38
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.14
LogP ≤ 50.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,2,2-trifluoroethylsulfinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2,2-trifluoroethylsulfinyl)acetic acid?
The IUPAC name of 2-(2,2,2-trifluoroethylsulfinyl)acetic acid (CID 20574023) is 2-(2,2,2-trifluoroethylsulfinyl)acetic acid.
What is the SMILES notation for 2-(2,2,2-trifluoroethylsulfinyl)acetic acid?
The canonical SMILES for 2-(2,2,2-trifluoroethylsulfinyl)acetic acid is O=C(O)CS(=O)CC(F)(F)F.
What is the InChIKey of 2-(2,2,2-trifluoroethylsulfinyl)acetic acid?
The InChIKey is FIAZTSFGZORROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3O3S/c5-4(6,7)2-11(10)1-3(8)9/h1-2H2,(H,8,9).
What are the key properties of 2-(2,2,2-trifluoroethylsulfinyl)acetic acid?
2-(2,2,2-trifluoroethylsulfinyl)acetic acid has a molecular weight of 190.14 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethylsulfinyl)acetic acid is sourced from PubChem (CID 20574023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).