C50H102N8 — CID 20574174
N'-[2-(6-aminohexylamino)ethyl]-N,N,1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 20574174) has the molecular formula C50H102N8 and a molecular weight of 815.42 g/mol. Its IUPAC name is N'-[2-(6-aminohexylamino)ethyl]-N,N,1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N'-[2-(6-aminohexylamino)ethyl]-N,N,1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 20574174 |
| Molecular Formula | C50H102N8 |
| Molecular Weight | 815.42 g/mol |
| Exact Mass | 814.82 |
| IUPAC Name | N'-[2-(6-aminohexylamino)ethyl]-N,N,1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CC1(C)CC(N(C2CC(C)(C)NC(C)(C)C2)C(CCCCCNCCNCCCCCCN)(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C50H102N8/c1-42(2)30-38(31-43(3,4)54-42)50(39-32-44(5,6)55-45(7,8)33-39,24-20-19-23-27-53-29-28-52-26-22-18-17-21-25-51)58(40-34-46(9,10)56-47(11,12)35-40)41-36-48(13,14)57-49(15,16)37-41/h38-41,52-57H,17-37,51H2,1-16H3 |
| InChIKey | JMEQTZGHICQQAD-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.42 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|