C28H52N2O4 — CID 20574175
bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl] hexanedioate (PubChem CID 20574175) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl] hexanedioate.
| Compound Name | bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl] hexanedioate |
|---|---|
| PubChem CID | 20574175 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl] hexanedioate |
| SMILES | CC1(C)CCCC(C)(C)N1CCOC(=O)CCCCC(=O)OCCN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C28H52N2O4/c1-25(2)15-11-16-26(3,4)29(25)19-21-33-23(31)13-9-10-14-24(32)34-22-20-30-27(5,6)17-12-18-28(30,7)8/h9-22H2,1-8H3 |
| InChIKey | BXBFHBNRDAZEAN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|