C15H20N2O2 — CID 20575257
6-butylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one (PubChem CID 20575257) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-butylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one.
| Compound Name | 6-butylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 20575257 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 6-butylspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one |
| SMILES | CCCCc1ccc2c(c1)C1(CCO2)NCNC1=O |
| InChI | InChI=1S/C15H20N2O2/c1-2-3-4-11-5-6-13-12(9-11)15(7-8-19-13)14(18)16-10-17-15/h5-6,9,17H,2-4,7-8,10H2,1H3,(H,16,18) |
| InChIKey | XYUUYDBSACDPNK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |