About (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate
(4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate (PubChem CID 20576329) has the molecular formula C23H26F4O3
and a molecular weight of 426.45 g/mol. Its IUPAC name is (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate |
| PubChem CID | 20576329 |
| Molecular Formula | C23H26F4O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate |
| SMILES | C=CC1CCC(OC(=O)C2CC=C(OC(F)(F)c3ccc(C)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C23H26F4O3/c1-3-15-5-9-17(10-6-15)29-22(28)16-7-11-18(12-8-16)30-23(26,27)19-13-4-14(2)20(24)21(19)25/h3-4,11,13,15-17H,1,5-10,12H2,2H3 |
| InChIKey | RHCFHBGAWDNPLN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate?
The IUPAC name of (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate (CID 20576329) is (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate.
What is the SMILES notation for (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate?
The canonical SMILES for (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate is C=CC1CCC(OC(=O)C2CC=C(OC(F)(F)c3ccc(C)c(F)c3F)CC2)CC1.
What is the InChIKey of (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate?
The InChIKey is RHCFHBGAWDNPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26F4O3/c1-3-15-5-9-17(10-6-15)29-22(28)16-7-11-18(12-8-16)30-23(26,27)19-13-4-14(2)20(24)21(19)25/h3-4,11,13,15-17H,1,5-10,12H2,2H3.
What are the key properties of (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate?
(4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate has a molecular weight of 426.45 g/mol, XLogP of 6.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylcyclohexyl) 4-[(2,3-difluoro-4-methylphenyl)-difluoromethoxy]cyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 20576329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).