C24H23FN2O4 — CID 20576475
N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide (PubChem CID 20576475) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide.
| Compound Name | N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 20576475 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2cc(O)c(NC(=O)c3ccccc3)cc2F)c(C)c1 |
| InChI | InChI=1S/C24H23FN2O4/c1-14-9-10-22(15(2)11-14)31-16(3)23(29)26-19-13-21(28)20(12-18(19)25)27-24(30)17-7-5-4-6-8-17/h4-13,16,28H,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | IFONXTRXPZGNMB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|