About N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide
N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide (PubChem CID 20576475) has the molecular formula C24H23FN2O4
and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide.
Molecular Properties
| Compound Name | N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide |
| PubChem CID | 20576475 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2cc(O)c(NC(=O)c3ccccc3)cc2F)c(C)c1 |
| InChI | InChI=1S/C24H23FN2O4/c1-14-9-10-22(15(2)11-14)31-16(3)23(29)26-19-13-21(28)20(12-18(19)25)27-24(30)17-7-5-4-6-8-17/h4-13,16,28H,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | IFONXTRXPZGNMB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide?
The IUPAC name of N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide (CID 20576475) is N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide.
What is the SMILES notation for N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide?
The canonical SMILES for N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide is Cc1ccc(OC(C)C(=O)Nc2cc(O)c(NC(=O)c3ccccc3)cc2F)c(C)c1.
What is the InChIKey of N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide?
The InChIKey is IFONXTRXPZGNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23FN2O4/c1-14-9-10-22(15(2)11-14)31-16(3)23(29)26-19-13-21(28)20(12-18(19)25)27-24(30)17-7-5-4-6-8-17/h4-13,16,28H,1-3H3,(H,26,29)(H,27,30).
What are the key properties of N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide?
N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide has a molecular weight of 422.46 g/mol, XLogP of 4.81, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-(2,4-dimethylphenoxy)propanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide is sourced from PubChem (CID 20576475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).