About phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate
phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate (PubChem CID 20576479) has the molecular formula C17H17F2NO4S
and a molecular weight of 369.39 g/mol. Its IUPAC name is phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate.
Molecular Properties
| Compound Name | phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate |
| PubChem CID | 20576479 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate |
| SMILES | CCc1c(F)cc(NC(=O)C(C)S(=O)Oc2ccccc2)c(O)c1F |
| InChI | InChI=1S/C17H17F2NO4S/c1-3-12-13(18)9-14(16(21)15(12)19)20-17(22)10(2)25(23)24-11-7-5-4-6-8-11/h4-10,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | YTZDXXIIKUVETA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate?
The IUPAC name of phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate (CID 20576479) is phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate.
What is the SMILES notation for phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate?
The canonical SMILES for phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate is CCc1c(F)cc(NC(=O)C(C)S(=O)Oc2ccccc2)c(O)c1F.
What is the InChIKey of phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate?
The InChIKey is YTZDXXIIKUVETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO4S/c1-3-12-13(18)9-14(16(21)15(12)19)20-17(22)10(2)25(23)24-11-7-5-4-6-8-11/h4-10,21H,3H2,1-2H3,(H,20,22).
What are the key properties of phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate?
phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate has a molecular weight of 369.39 g/mol, XLogP of 3.30, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 1-(4-ethyl-3,5-difluoro-2-hydroxyanilino)-1-oxopropane-2-sulfinate is sourced from PubChem (CID 20576479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).