C10H18O3W — CID 20576708
carbanide;3-methoxy-4,5-dimethyl-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+) (PubChem CID 20576708) has the molecular formula C10H18O3W and a molecular weight of 370.09 g/mol. Its IUPAC name is carbanide;3-methoxy-4,5-dimethyl-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+).
| Compound Name | carbanide;3-methoxy-4,5-dimethyl-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+) |
|---|---|
| PubChem CID | 20576708 |
| Molecular Formula | C10H18O3W |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | carbanide;3-methoxy-4,5-dimethyl-3,4,5,6-tetrahydro-2H-pyran-6-ide-2-carbaldehyde;tungsten(2+) |
| SMILES | COC1C(C=O)O[CH-]C(C)C1C.[CH3-].[W+2] |
| InChI | InChI=1S/C9H15O3.CH3.W/c1-6-5-12-8(4-10)9(11-3)7(6)2;;/h4-9H,1-3H3;1H3;/q2*-1;+2 |
| InChIKey | AWCFJDGUKHCUFX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|