About 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate
2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate (PubChem CID 20576723) has the molecular formula C16H18O8
and a molecular weight of 338.31 g/mol. Its IUPAC name is 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate.
Molecular Properties
| Compound Name | 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate |
| PubChem CID | 20576723 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate |
| SMILES | CC#CC#CC(=O)OCCOC(=O)CC(=O)C(C)OC(=O)C(C)O |
| InChI | InChI=1S/C16H18O8/c1-4-5-6-7-14(19)22-8-9-23-15(20)10-13(18)12(3)24-16(21)11(2)17/h11-12,17H,8-10H2,1-3H3 |
| InChIKey | NPYVQCWBLBIFDV-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate?
The IUPAC name of 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate (CID 20576723) is 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate.
What is the SMILES notation for 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate?
The canonical SMILES for 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate is CC#CC#CC(=O)OCCOC(=O)CC(=O)C(C)OC(=O)C(C)O.
What is the InChIKey of 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate?
The InChIKey is NPYVQCWBLBIFDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O8/c1-4-5-6-7-14(19)22-8-9-23-15(20)10-13(18)12(3)24-16(21)11(2)17/h11-12,17H,8-10H2,1-3H3.
What are the key properties of 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate?
2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate has a molecular weight of 338.31 g/mol, XLogP of -0.63, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-hydroxypropanoyloxy)-3-oxopentanoyl]oxyethyl hexa-2,4-diynoate is sourced from PubChem (CID 20576723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).