C35H46Si — CID 20576735
bis(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-methyl-octylsilane (PubChem CID 20576735) has the molecular formula C35H46Si and a molecular weight of 494.84 g/mol. Its IUPAC name is bis(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-methyl-octylsilane.
| Compound Name | bis(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-methyl-octylsilane |
|---|---|
| PubChem CID | 20576735 |
| Molecular Formula | C35H46Si |
| Molecular Weight | 494.84 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | bis(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-methyl-octylsilane |
| SMILES | CCCCCCCC[Si](C)(C1C2C=CC=CC2C2C=CC=CC21)C1C2C=CC=CC2C2C=CC=CC21 |
| InChI | InChI=1S/C35H46Si/c1-3-4-5-6-7-16-25-36(2,34-30-21-12-8-17-26(30)27-18-9-13-22-31(27)34)35-32-23-14-10-19-28(32)29-20-11-15-24-33(29)35/h8-15,17-24,26-35H,3-7,16,25H2,1-2H3 |
| InChIKey | JVKCSVBSCIDKHJ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.84 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|