C8H6F12NO2+ — CID 20576768
2,2,3,4,5,5-hexafluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)morpholin-4-ium (PubChem CID 20576768) has the molecular formula C8H6F12NO2+ and a molecular weight of 376.12 g/mol. Its IUPAC name is 2,2,3,4,5,5-hexafluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)morpholin-4-ium.
| Compound Name | 2,2,3,4,5,5-hexafluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)morpholin-4-ium |
|---|---|
| PubChem CID | 20576768 |
| Molecular Formula | C8H6F12NO2+ |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2,2,3,4,5,5-hexafluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)morpholin-4-ium |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)[N+]1(F)C(F)C(F)(F)OCC1(F)F |
| InChI | InChI=1S/C8H6F12NO2/c1-22-8(18,19)6(14,15)7(16,17)21(20)3(9)5(12,13)23-2-4(21,10)11/h3H,2H2,1H3/q+1 |
| InChIKey | QSDALUHISPVSGB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|