C18H16N2 — CID 20576823
(13S,20S)-10,15-diazapentacyclo[11.6.1.02,11.03,8.016,20]icosa-2,4,6,8,14,16,18-heptaene (PubChem CID 20576823) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (13S,20S)-10,15-diazapentacyclo[11.6.1.02,11.03,8.016,20]icosa-2,4,6,8,14,16,18-heptaene.
| Compound Name | (13S,20S)-10,15-diazapentacyclo[11.6.1.02,11.03,8.016,20]icosa-2,4,6,8,14,16,18-heptaene |
|---|---|
| PubChem CID | 20576823 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (13S,20S)-10,15-diazapentacyclo[11.6.1.02,11.03,8.016,20]icosa-2,4,6,8,14,16,18-heptaene |
| SMILES | C1=CC2C3=c4ccccc4=CNC3C[C@@H]3C=NC(=C1)[C@@H]23 |
| InChI | InChI=1S/C18H16N2/c1-2-5-13-11(4-1)9-20-16-8-12-10-19-15-7-3-6-14(17(12)15)18(13)16/h1-7,9-10,12,14,16-17,20H,8H2/t12-,14?,16?,17-/m1/s1 |
| InChIKey | IZVIGEDPMAQPED-BZVDIIDJSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |