About 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline
3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline (PubChem CID 20577315) has the molecular formula C30H27N3
and a molecular weight of 429.57 g/mol. Its IUPAC name is 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline.
Molecular Properties
| Compound Name | 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline |
| PubChem CID | 20577315 |
| Molecular Formula | C30H27N3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline |
| SMILES | CCCn1c(-c2ccccc2-c2cccc(N)c2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H27N3/c1-2-20-33-29(23-14-7-4-8-15-23)28(22-12-5-3-6-13-22)32-30(33)27-19-10-9-18-26(27)24-16-11-17-25(31)21-24/h3-19,21H,2,20,31H2,1H3 |
| InChIKey | WZVZSVTXNFIKJY-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline?
The IUPAC name of 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline (CID 20577315) is 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline.
What is the SMILES notation for 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline?
The canonical SMILES for 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline is CCCn1c(-c2ccccc2-c2cccc(N)c2)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline?
The InChIKey is WZVZSVTXNFIKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27N3/c1-2-20-33-29(23-14-7-4-8-15-23)28(22-12-5-3-6-13-22)32-30(33)27-19-10-9-18-26(27)24-16-11-17-25(31)21-24/h3-19,21H,2,20,31H2,1H3.
What are the key properties of 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline?
3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline has a molecular weight of 429.57 g/mol, XLogP of 7.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)phenyl]aniline is sourced from PubChem (CID 20577315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).