C16H30O2 — CID 20577413
4,4-dimethyl-2-(2-methylprop-1-enyl)-5,6-di(propan-2-yl)-1,3-dioxane (PubChem CID 20577413) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2-methylprop-1-enyl)-5,6-di(propan-2-yl)-1,3-dioxane.
| Compound Name | 4,4-dimethyl-2-(2-methylprop-1-enyl)-5,6-di(propan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 20577413 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 4,4-dimethyl-2-(2-methylprop-1-enyl)-5,6-di(propan-2-yl)-1,3-dioxane |
| SMILES | CC(C)=CC1OC(C(C)C)C(C(C)C)C(C)(C)O1 |
| InChI | InChI=1S/C16H30O2/c1-10(2)9-13-17-15(12(5)6)14(11(3)4)16(7,8)18-13/h9,11-15H,1-8H3 |
| InChIKey | ARTNNEDLIFMRFQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|