C34H62O8 — CID 20577430
2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxan-2-yl]oxyoxane (PubChem CID 20577430) has the molecular formula C34H62O8 and a molecular weight of 598.86 g/mol. Its IUPAC name is 2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxan-2-yl]oxyoxane.
| Compound Name | 2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 20577430 |
| Molecular Formula | C34H62O8 |
| Molecular Weight | 598.86 g/mol |
| Exact Mass | 598.44 |
| IUPAC Name | 2-methoxy-3,5,6-trimethyl-4-[3,4,6-trimethyl-5-[3,4,6-trimethyl-5-(3,4,5,6-tetramethyloxan-2-yl)oxyoxan-2-yl]oxyoxan-2-yl]oxyoxane |
| SMILES | COC1OC(C)C(C)C(OC2OC(C)C(OC3OC(C)C(OC4OC(C)C(C)C(C)C4C)C(C)C3C)C(C)C2C)C1C |
| InChI | InChI=1S/C34H62O8/c1-15-16(2)24(10)37-32(19(15)5)41-29-18(4)21(7)34(39-27(29)13)42-30-17(3)20(6)33(38-26(30)12)40-28-22(8)25(11)36-31(35-14)23(28)9/h15-34H,1-14H3 |
| InChIKey | JJAKLISJQRXCHN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.86 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |