C33H41NO7 — CID 20577546
1-O-[(E)-anthracen-9-ylmethylideneamino] 5-O-(4-hydroxybutyl) 3-O-methyl 1,1,3-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 20577546) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is 1-O-[(E)-anthracen-9-ylmethylideneamino] 5-O-(4-hydroxybutyl) 3-O-methyl 1,1,3-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-[(E)-anthracen-9-ylmethylideneamino] 5-O-(4-hydroxybutyl) 3-O-methyl 1,1,3-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20577546 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 1-O-[(E)-anthracen-9-ylmethylideneamino] 5-O-(4-hydroxybutyl) 3-O-methyl 1,1,3-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(C)(CC(C)(C)C(=O)O/N=C/c1c2ccccc2cc2ccccc12)C(=O)OC)C(=O)OCCCCO |
| InChI | InChI=1S/C33H41NO7/c1-6-23(29(36)40-18-12-11-17-35)20-33(4,31(38)39-5)22-32(2,3)30(37)41-34-21-28-26-15-9-7-13-24(26)19-25-14-8-10-16-27(25)28/h7-10,13-16,19,21,23,35H,6,11-12,17-18,20,22H2,1-5H3/b34-21+ |
| InChIKey | FDBNCMMMMSROEB-KEIPNQJHSA-N |
| XLogP | 6.20 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|