C34H37N3O7S3 — CID 20577791
(2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid (PubChem CID 20577791) has the molecular formula C34H37N3O7S3 and a molecular weight of 695.89 g/mol. Its IUPAC name is (2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 20577791 |
| Molecular Formula | C34H37N3O7S3 |
| Molecular Weight | 695.89 g/mol |
| Exact Mass | 695.18 |
| IUPAC Name | (2R)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]propanoic acid |
| SMILES | CCCCCCCSc1nc2ccc(S(=O)(=O)N[C@H](Cc3ccc(OCCCN4C(=O)c5ccccc5C4=O)cc3)C(=O)O)cc2s1 |
| InChI | InChI=1S/C34H37N3O7S3/c1-2-3-4-5-8-20-45-34-35-28-17-16-25(22-30(28)46-34)47(42,43)36-29(33(40)41)21-23-12-14-24(15-13-23)44-19-9-18-37-31(38)26-10-6-7-11-27(26)32(37)39/h6-7,10-17,22,29,36H,2-5,8-9,18-21H2,1H3,(H,40,41)/t29-/m1/s1 |
| InChIKey | CGSHFPDPUWULJM-GDLZYMKVSA-N |
| XLogP | 6.40 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.89 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|