C22H33N3O6S3 — CID 20577809
ethyl 2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl-[(2R)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]amino]acetate (PubChem CID 20577809) has the molecular formula C22H33N3O6S3 and a molecular weight of 531.72 g/mol. Its IUPAC name is ethyl 2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl-[(2R)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]amino]acetate.
| Compound Name | ethyl 2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl-[(2R)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 20577809 |
| Molecular Formula | C22H33N3O6S3 |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | ethyl 2-[(2-hexylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl-[(2R)-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]amino]acetate |
| SMILES | CCCCCCSc1nc2ccc(S(=O)(=O)N(CC(=O)OCC)[C@@H](C(=O)NO)C(C)C)cc2s1 |
| InChI | InChI=1S/C22H33N3O6S3/c1-5-7-8-9-12-32-22-23-17-11-10-16(13-18(17)33-22)34(29,30)25(14-19(26)31-6-2)20(15(3)4)21(27)24-28/h10-11,13,15,20,28H,5-9,12,14H2,1-4H3,(H,24,27)/t20-/m1/s1 |
| InChIKey | WFOQHDJPRWAFRI-HXUWFJFHSA-N |
| XLogP | 4.05 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|