C35H18F12N2O4 — CID 20578093
5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20578093) has the molecular formula C35H18F12N2O4 and a molecular weight of 758.51 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20578093 |
| Molecular Formula | C35H18F12N2O4 |
| Molecular Weight | 758.51 g/mol |
| Exact Mass | 758.11 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[4-[4-methyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H18F12N2O4/c1-15-3-7-19(25(11-15)32(36,37)38)20-10-6-18(14-26(20)33(39,40)41)49-29(52)22-9-5-17(13-24(22)30(49)53)31(34(42,43)44,35(45,46)47)16-4-8-21-23(12-16)28(51)48(2)27(21)50/h3-14H,1-2H3 |
| InChIKey | SWWXQTGEEBYLOP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.51 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|