C35H39N5O6 — CID 20579292
2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboxylate (PubChem CID 20579292) has the molecular formula C35H39N5O6 and a molecular weight of 625.73 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboxylate.
| Compound Name | 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 20579292 |
| Molecular Formula | C35H39N5O6 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | 2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]ethyl 4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carboxylate |
| SMILES | O=C(/C=C/c1ccc(CN(CCOC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)CCc2c[nH]c3ccccc23)cc1)NO |
| InChI | InChI=1S/C35H39N5O6/c41-34(37-43)12-10-26-5-7-27(8-6-26)23-38(14-13-29-22-36-31-4-2-1-3-30(29)31)19-20-44-35(42)40-17-15-39(16-18-40)24-28-9-11-32-33(21-28)46-25-45-32/h1-12,21-22,36,43H,13-20,23-25H2,(H,37,41)/b12-10+ |
| InChIKey | FGCXDMHYXXTSEF-ZRDIBKRKSA-N |
| XLogP | 4.41 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|